About bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+)
bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) (PubChem CID 54607432) has the molecular formula C16H34N2NiO6P2
and a molecular weight of 471.10 g/mol. Its IUPAC name is bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+).
Molecular Properties
| Compound Name | bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) |
| PubChem CID | 54607432 |
| Molecular Formula | C16H34N2NiO6P2 |
| Molecular Weight | 471.10 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) |
| SMILES | CCOP(=O)(O)C1CCCC(C)[N-]1.CCOP(=O)(O)C1CCCC(C)[N-]1.[Ni+2] |
| InChI | InChI=1S/2C8H17NO3P.Ni/c2*1-3-12-13(10,11)8-6-4-5-7(2)9-8;/h2*7-8H,3-6H2,1-2H3,(H,10,11);/q2*-1;+2 |
| InChIKey | VDEBKKMQMZARIY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.10 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+)?
The IUPAC name of bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) (CID 54607432) is bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+).
What is the SMILES notation for bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+)?
The canonical SMILES for bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) is CCOP(=O)(O)C1CCCC(C)[N-]1.CCOP(=O)(O)C1CCCC(C)[N-]1.[Ni+2].
What is the InChIKey of bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+)?
The InChIKey is VDEBKKMQMZARIY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17NO3P.Ni/c2*1-3-12-13(10,11)8-6-4-5-7(2)9-8;/h2*7-8H,3-6H2,1-2H3,(H,10,11);/q2*-1;+2.
What are the key properties of bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+)?
bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) has a molecular weight of 471.10 g/mol, XLogP of 4.96, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethoxy-(6-methylpiperidin-1-id-2-yl)phosphinic acid);nickel(2+) is sourced from PubChem (CID 54607432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).