C22H24N2O6 — CID 50908491
trimethyl (2R,3S,4S,5S)-2-benzyl-5-pyridin-2-ylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 50908491) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is trimethyl (2R,3S,4S,5S)-2-benzyl-5-pyridin-2-ylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2R,3S,4S,5S)-2-benzyl-5-pyridin-2-ylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 50908491 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | trimethyl (2R,3S,4S,5S)-2-benzyl-5-pyridin-2-ylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccn2)N[C@@](Cc2ccccc2)(C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H24N2O6/c1-28-19(25)16-17(20(26)29-2)22(21(27)30-3,13-14-9-5-4-6-10-14)24-18(16)15-11-7-8-12-23-15/h4-12,16-18,24H,13H2,1-3H3/t16-,17+,18+,22+/m0/s1 |
| InChIKey | UVVCRVUZFWUDNF-KCXPTXFHSA-N |
| XLogP | 1.46 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|