C21H22N2O5 — CID 11901785
methyl (1R,3R,3aR,6aR)-3-benzyl-5-ethyl-1-(furan-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 11901785) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl (1R,3R,3aR,6aR)-3-benzyl-5-ethyl-1-(furan-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3R,3aR,6aR)-3-benzyl-5-ethyl-1-(furan-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11901785 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl (1R,3R,3aR,6aR)-3-benzyl-5-ethyl-1-(furan-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](C1=O)[C@](Cc1ccccc1)(C(=O)OC)N[C@H]2c1ccco1 |
| InChI | InChI=1S/C21H22N2O5/c1-3-23-18(24)15-16(19(23)25)21(20(26)27-2,12-13-8-5-4-6-9-13)22-17(15)14-10-7-11-28-14/h4-11,15-17,22H,3,12H2,1-2H3/t15-,16+,17+,21-/m1/s1 |
| InChIKey | PPZBRQLENLRYBO-MXTNKPTQSA-N |
| XLogP | 1.70 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|