C21H22N2O5S — CID 7401694
methyl (1R,3R,3aS,6aS)-5-ethyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 7401694) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl (1R,3R,3aS,6aS)-5-ethyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3R,3aS,6aS)-5-ethyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7401694 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | methyl (1R,3R,3aS,6aS)-5-ethyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCN1C(=O)[C@@H]2[C@H](c3cccs3)N[C@@](Cc3ccc(O)cc3)(C(=O)OC)[C@H]2C1=O |
| InChI | InChI=1S/C21H22N2O5S/c1-3-23-18(25)15-16(19(23)26)21(20(27)28-2,11-12-6-8-13(24)9-7-12)22-17(15)14-5-4-10-29-14/h4-10,15-17,22,24H,3,11H2,1-2H3/t15-,16+,17-,21+/m0/s1 |
| InChIKey | OVMFQWRYXSAZGP-GRXQJBFDSA-N |
| XLogP | 1.87 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|