C18H24N2O4S — CID 100911777
ethyl (1S,3S,3aS,6aR)-5-ethyl-4,6-dioxo-3-propyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 100911777) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is ethyl (1S,3S,3aS,6aR)-5-ethyl-4,6-dioxo-3-propyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1S,3S,3aS,6aR)-5-ethyl-4,6-dioxo-3-propyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 100911777 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl (1S,3S,3aS,6aR)-5-ethyl-4,6-dioxo-3-propyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCC[C@]1(C(=O)OCC)N[C@H](c2cccs2)[C@@H]2C(=O)N(CC)C(=O)[C@@H]21 |
| InChI | InChI=1S/C18H24N2O4S/c1-4-9-18(17(23)24-6-3)13-12(15(21)20(5-2)16(13)22)14(19-18)11-8-7-10-25-11/h7-8,10,12-14,19H,4-6,9H2,1-3H3/t12-,13-,14-,18+/m1/s1 |
| InChIKey | JMAYTTKKIKIUGQ-MMQJMDILSA-N |
| XLogP | 2.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|