C31H29N3O6 — CID 71659677
tert-butyl (1R,2R,3R,4S,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate (PubChem CID 71659677) has the molecular formula C31H29N3O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is tert-butyl (1R,2R,3R,4S,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl (1R,2R,3R,4S,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 71659677 |
| Molecular Formula | C31H29N3O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | tert-butyl (1R,2R,3R,4S,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@]2(c3ccccc31)[C@H](O)C[C@@H](c1ccccc1)[C@@H]([N+](=O)[O-])[C@@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C31H29N3O6/c1-30(2,3)40-29(37)33-24-12-8-7-11-23(24)31(28(33)36)25(35)17-22(20-9-5-4-6-10-20)27(34(38)39)26(31)21-15-13-19(18-32)14-16-21/h4-16,22,25-27,35H,17H2,1-3H3/t22-,25+,26-,27+,31+/m0/s1 |
| InChIKey | RIGLFTQGAWWJSY-JQLZVFTOSA-N |
| XLogP | 5.06 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|