C23H22N2O7 — CID 154713553
dimethyl (2R,3R,4R,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-4-phenylcyclohexane-1,1-dicarboxylate (PubChem CID 154713553) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is dimethyl (2R,3R,4R,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-4-phenylcyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl (2R,3R,4R,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-4-phenylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 154713553 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | dimethyl (2R,3R,4R,6R)-2-(4-cyanophenyl)-6-hydroxy-3-nitro-4-phenylcyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@H](O)C[C@H](c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H22N2O7/c1-31-21(27)23(22(28)32-2)18(26)12-17(15-6-4-3-5-7-15)20(25(29)30)19(23)16-10-8-14(13-24)9-11-16/h3-11,17-20,26H,12H2,1-2H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | WFCTVYUKIVEXOW-YSTOQKLRSA-N |
| XLogP | 2.17 |
| TPSA | 139.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|