C19H30O3Si — CID 100995200
[(3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-1-(methoxymethyl)-4-methylcyclopentyl] acetate (PubChem CID 100995200) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is [(3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-1-(methoxymethyl)-4-methylcyclopentyl] acetate.
| Compound Name | [(3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-1-(methoxymethyl)-4-methylcyclopentyl] acetate |
|---|---|
| PubChem CID | 100995200 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [(3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-1-(methoxymethyl)-4-methylcyclopentyl] acetate |
| SMILES | COCC1(OC(C)=O)C[C@@H](C[Si](C)(C)c2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C19H30O3Si/c1-15-11-19(14-21-3,22-16(2)20)12-17(15)13-23(4,5)18-9-7-6-8-10-18/h6-10,15,17H,11-14H2,1-5H3/t15-,17+,19?/m1/s1 |
| InChIKey | DYBXXICDQHQFOG-GIAWROPOSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|