C18H34O4Si — CID 101039601
trans-dimethyl (3R,4R)-3-ethyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 101039601) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is trans-dimethyl (3R,4R)-3-ethyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3R,4R)-3-ethyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101039601 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | trans-dimethyl (3R,4R)-3-ethyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CC[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@H]1C[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H34O4Si/c1-7-14-11-18(16(19)21-5,17(20)22-6)12-15(14)13-23(8-2,9-3)10-4/h14-15H,7-13H2,1-6H3/t14-,15+/m1/s1 |
| InChIKey | QOSFZOBREMHKLC-CABCVRRESA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|