C21H40O4Si — CID 101010846
diethyl 3-ethyl-4-(triethylsilylmethyl)cyclohexane-1,1-dicarboxylate (PubChem CID 101010846) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is diethyl 3-ethyl-4-(triethylsilylmethyl)cyclohexane-1,1-dicarboxylate.
| Compound Name | diethyl 3-ethyl-4-(triethylsilylmethyl)cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101010846 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | diethyl 3-ethyl-4-(triethylsilylmethyl)cyclohexane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(C[Si](CC)(CC)CC)C(CC)C1 |
| InChI | InChI=1S/C21H40O4Si/c1-7-17-15-21(19(22)24-8-2,20(23)25-9-3)14-13-18(17)16-26(10-4,11-5)12-6/h17-18H,7-16H2,1-6H3 |
| InChIKey | MWAVLQZRRUNTJL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|