C15H28O2Si — CID 134901015
methyl 2-[(1R,2R)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclopentyl]acetate (PubChem CID 134901015) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2R)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 134901015 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | methyl 2-[(1R,2R)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclopentyl]acetate |
| SMILES | COC(=O)C[C@H]1CCC[C@H]1/C=C/C(C)[Si](C)(C)C |
| InChI | InChI=1S/C15H28O2Si/c1-12(18(3,4)5)9-10-13-7-6-8-14(13)11-15(16)17-2/h9-10,12-14H,6-8,11H2,1-5H3/b10-9+/t12?,13-,14+/m0/s1 |
| InChIKey | NEPGIBHTVKGTRY-NISXXQHKSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|