C28H54O5SiSn — CID 177430470
cis-dimethyl (3S,4R)-3-[(Z)-3-tributylstannylprop-1-enyl]-4-trimethylsilyloxycyclohexane-1,1-dicarboxylate (PubChem CID 177430470) has the molecular formula C28H54O5SiSn and a molecular weight of 617.53 g/mol. Its IUPAC name is cis-dimethyl (3S,4R)-3-[(Z)-3-tributylstannylprop-1-enyl]-4-trimethylsilyloxycyclohexane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3S,4R)-3-[(Z)-3-tributylstannylprop-1-enyl]-4-trimethylsilyloxycyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177430470 |
| Molecular Formula | C28H54O5SiSn |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | cis-dimethyl (3S,4R)-3-[(Z)-3-tributylstannylprop-1-enyl]-4-trimethylsilyloxycyclohexane-1,1-dicarboxylate |
| SMILES | CCCC[Sn](C/C=C\[C@@H]1CC(C(=O)OC)(C(=O)OC)CC[C@H]1O[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C16H27O5Si.3C4H9.Sn/c1-7-8-12-11-16(14(17)19-2,15(18)20-3)10-9-13(12)21-22(4,5)6;3*1-3-4-2;/h7-8,12-13H,1,9-11H2,2-6H3;3*1,3-4H2,2H3;/b8-7-;;;;/t12-,13-;;;;/m1..../s1 |
| InChIKey | DCTOPCFAHQZYKT-HAOHNGNFSA-N |
| XLogP | 7.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|