C25H46O4Sn — CID 177495904
trans-dimethyl (3S,4S)-4-ethenyl-3-methyl-3-(tributylstannylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 177495904) has the molecular formula C25H46O4Sn and a molecular weight of 529.35 g/mol. Its IUPAC name is trans-dimethyl (3S,4S)-4-ethenyl-3-methyl-3-(tributylstannylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4S)-4-ethenyl-3-methyl-3-(tributylstannylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177495904 |
| Molecular Formula | C25H46O4Sn |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | trans-dimethyl (3S,4S)-4-ethenyl-3-methyl-3-(tributylstannylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@]1(C)C[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C13H19O4.3C4H9.Sn/c1-6-9-7-13(10(14)16-4,11(15)17-5)8-12(9,2)3;3*1-3-4-2;/h6,9H,1-2,7-8H2,3-5H3;3*1,3-4H2,2H3;/t9-,12-;;;;/m1..../s1 |
| InChIKey | COYRHTWDKCQCPS-VUAFBSFLSA-N |
| XLogP | 6.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|