About tetrabutylstannane;trimethyl(trimethylsilyloxy)silane
tetrabutylstannane;trimethyl(trimethylsilyloxy)silane (PubChem CID 18413452) has the molecular formula C22H54OSi2Sn
and a molecular weight of 509.56 g/mol. Its IUPAC name is tetrabutylstannane;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | tetrabutylstannane;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 18413452 |
| Molecular Formula | C22H54OSi2Sn |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | tetrabutylstannane;trimethyl(trimethylsilyloxy)silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CCCC.C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C6H18OSi2.4C4H9.Sn/c1-8(2,3)7-9(4,5)6;4*1-3-4-2;/h1-6H3;4*1,3-4H2,2H3; |
| InChIKey | GEXCECNKCBKUHO-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylstannane;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylstannane;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of tetrabutylstannane;trimethyl(trimethylsilyloxy)silane (CID 18413452) is tetrabutylstannane;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for tetrabutylstannane;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for tetrabutylstannane;trimethyl(trimethylsilyloxy)silane is CCCC[Sn](CCCC)(CCCC)CCCC.C[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of tetrabutylstannane;trimethyl(trimethylsilyloxy)silane?
The InChIKey is GEXCECNKCBKUHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18OSi2.4C4H9.Sn/c1-8(2,3)7-9(4,5)6;4*1-3-4-2;/h1-6H3;4*1,3-4H2,2H3;.
What are the key properties of tetrabutylstannane;trimethyl(trimethylsilyloxy)silane?
tetrabutylstannane;trimethyl(trimethylsilyloxy)silane has a molecular weight of 509.56 g/mol, XLogP of 9.31, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylstannane;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 18413452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).