About lithium tributyl(propyl)stannane
lithium tributyl(propyl)stannane (PubChem CID 11348350) has the molecular formula C15H33LiSn
and a molecular weight of 339.08 g/mol. Its IUPAC name is lithium tributyl(propyl)stannane.
Molecular Properties
| Compound Name | lithium tributyl(propyl)stannane |
| PubChem CID | 11348350 |
| Molecular Formula | C15H33LiSn |
| Molecular Weight | 339.08 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | lithium tributyl(propyl)stannane |
| SMILES | [CH2-]CC[Sn](CCCC)(CCCC)CCCC.[Li+] |
| InChI | InChI=1S/3C4H9.C3H6.Li.Sn/c3*1-3-4-2;1-3-2;;/h3*1,3-4H2,2H3;1-3H2;;/q;;;-1;+1; |
| InChIKey | HLGLKMOBNCGGQP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.08 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium tributyl(propyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium tributyl(propyl)stannane?
The IUPAC name of lithium tributyl(propyl)stannane (CID 11348350) is lithium tributyl(propyl)stannane.
What is the SMILES notation for lithium tributyl(propyl)stannane?
The canonical SMILES for lithium tributyl(propyl)stannane is [CH2-]CC[Sn](CCCC)(CCCC)CCCC.[Li+].
What is the InChIKey of lithium tributyl(propyl)stannane?
The InChIKey is HLGLKMOBNCGGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3H6.Li.Sn/c3*1-3-4-2;1-3-2;;/h3*1,3-4H2,2H3;1-3H2;;/q;;;-1;+1;.
What are the key properties of lithium tributyl(propyl)stannane?
lithium tributyl(propyl)stannane has a molecular weight of 339.08 g/mol, XLogP of 3.06, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium tributyl(propyl)stannane is sourced from PubChem (CID 11348350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).