About tetrabutylstannane;hydrate
tetrabutylstannane;hydrate (PubChem CID 87560971) has the molecular formula C16H38OSn
and a molecular weight of 365.19 g/mol. Its IUPAC name is tetrabutylstannane;hydrate.
Molecular Properties
| Compound Name | tetrabutylstannane;hydrate |
| PubChem CID | 87560971 |
| Molecular Formula | C16H38OSn |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | tetrabutylstannane;hydrate |
| SMILES | CCCC[Sn](CCCC)(CCCC)CCCC.O |
| InChI | InChI=1S/4C4H9.H2O.Sn/c4*1-3-4-2;;/h4*1,3-4H2,2H3;1H2; |
| InChIKey | IBXAKBFNNATWIG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetrabutylstannane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylstannane;hydrate?
The IUPAC name of tetrabutylstannane;hydrate (CID 87560971) is tetrabutylstannane;hydrate.
What is the SMILES notation for tetrabutylstannane;hydrate?
The canonical SMILES for tetrabutylstannane;hydrate is CCCC[Sn](CCCC)(CCCC)CCCC.O.
What is the InChIKey of tetrabutylstannane;hydrate?
The InChIKey is IBXAKBFNNATWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/4C4H9.H2O.Sn/c4*1-3-4-2;;/h4*1,3-4H2,2H3;1H2;.
What are the key properties of tetrabutylstannane;hydrate?
tetrabutylstannane;hydrate has a molecular weight of 365.19 g/mol, XLogP of 5.81, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylstannane;hydrate is sourced from PubChem (CID 87560971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).