C14H26F6Sn — CID 154327480
dibutyl-bis(3,3,3-trifluoropropyl)stannane (PubChem CID 154327480) has the molecular formula C14H26F6Sn and a molecular weight of 427.06 g/mol. Its IUPAC name is dibutyl-bis(3,3,3-trifluoropropyl)stannane.
| Compound Name | dibutyl-bis(3,3,3-trifluoropropyl)stannane |
|---|---|
| PubChem CID | 154327480 |
| Molecular Formula | C14H26F6Sn |
| Molecular Weight | 427.06 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | dibutyl-bis(3,3,3-trifluoropropyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/2C4H9.2C3H4F3.Sn/c2*1-3-4-2;2*1-2-3(4,5)6;/h2*1,3-4H2,2H3;2*1-2H2; |
| InChIKey | AQNDORNNUQNCAH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.06 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |