C26H50F6O2Sn — CID 87372284
di(nonoxy)-bis(4,4,4-trifluorobutyl)stannane (PubChem CID 87372284) has the molecular formula C26H50F6O2Sn and a molecular weight of 627.38 g/mol. Its IUPAC name is di(nonoxy)-bis(4,4,4-trifluorobutyl)stannane.
| Compound Name | di(nonoxy)-bis(4,4,4-trifluorobutyl)stannane |
|---|---|
| PubChem CID | 87372284 |
| Molecular Formula | C26H50F6O2Sn |
| Molecular Weight | 627.38 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | di(nonoxy)-bis(4,4,4-trifluorobutyl)stannane |
| SMILES | CCCCCCCCCO[Sn](CCCC(F)(F)F)(CCCC(F)(F)F)OCCCCCCCCC |
| InChI | InChI=1S/2C9H19O.2C4H6F3.Sn/c2*1-2-3-4-5-6-7-8-9-10;2*1-2-3-4(5,6)7;/h2*2-9H2,1H3;2*1-3H2;/q2*-1;;;+2 |
| InChIKey | XCQNVBNFZUROGS-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.38 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|