About butyl(trioctyl)stannane;hydrochloride
butyl(trioctyl)stannane;hydrochloride (PubChem CID 175572560) has the molecular formula C28H61ClSn
and a molecular weight of 551.96 g/mol. Its IUPAC name is butyl(trioctyl)stannane;hydrochloride.
Molecular Properties
| Compound Name | butyl(trioctyl)stannane;hydrochloride |
| PubChem CID | 175572560 |
| Molecular Formula | C28H61ClSn |
| Molecular Weight | 551.96 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | butyl(trioctyl)stannane;hydrochloride |
| SMILES | CCCCCCCC[Sn](CCCC)(CCCCCCCC)CCCCCCCC.Cl |
| InChI | InChI=1S/3C8H17.C4H9.ClH.Sn/c3*1-3-5-7-8-6-4-2;1-3-4-2;;/h3*1,3-8H2,2H3;1,3-4H2,2H3;1H; |
| InChIKey | VRZNHATVVLZCPS-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.96 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl(trioctyl)stannane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trioctyl)stannane;hydrochloride?
The IUPAC name of butyl(trioctyl)stannane;hydrochloride (CID 175572560) is butyl(trioctyl)stannane;hydrochloride.
What is the SMILES notation for butyl(trioctyl)stannane;hydrochloride?
The canonical SMILES for butyl(trioctyl)stannane;hydrochloride is CCCCCCCC[Sn](CCCC)(CCCCCCCC)CCCCCCCC.Cl.
What is the InChIKey of butyl(trioctyl)stannane;hydrochloride?
The InChIKey is VRZNHATVVLZCPS-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H17.C4H9.ClH.Sn/c3*1-3-5-7-8-6-4-2;1-3-4-2;;/h3*1,3-8H2,2H3;1,3-4H2,2H3;1H;.
What are the key properties of butyl(trioctyl)stannane;hydrochloride?
butyl(trioctyl)stannane;hydrochloride has a molecular weight of 551.96 g/mol, XLogP of 11.74, 24 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trioctyl)stannane;hydrochloride is sourced from PubChem (CID 175572560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).