C30H54B2O8 — CID 177405370
trans-dimethyl (3S,4S)-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]cyclopentane-1,1-dicarboxylate (PubChem CID 177405370) has the molecular formula C30H54B2O8 and a molecular weight of 564.38 g/mol. Its IUPAC name is trans-dimethyl (3S,4S)-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4S)-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177405370 |
| Molecular Formula | C30H54B2O8 |
| Molecular Weight | 564.38 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | trans-dimethyl (3S,4S)-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](CCCCCCCCB2OC(C)(C)C(C)(C)O2)[C@@H](CB2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C30H54B2O8/c1-26(2)27(3,4)38-31(37-26)18-16-14-12-11-13-15-17-22-19-30(24(33)35-9,25(34)36-10)20-23(22)21-32-39-28(5,6)29(7,8)40-32/h22-23H,11-21H2,1-10H3/t22-,23+/m0/s1 |
| InChIKey | DKMXRDOWBOFINV-XZOQPEGZSA-N |
| XLogP | 6.26 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.38 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|