C16H30BNO4 — CID 158634542
trans-(1R,3S)-3-amino-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]cyclopentane-1-carboxylic acid (PubChem CID 158634542) has the molecular formula C16H30BNO4 and a molecular weight of 311.23 g/mol. Its IUPAC name is trans-(1R,3S)-3-amino-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-amino-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 158634542 |
| Molecular Formula | C16H30BNO4 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | trans-(1R,3S)-3-amino-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]cyclopentane-1-carboxylic acid |
| SMILES | CC1(C)OB(CCCC[C@@]2(C(=O)O)CC[C@H](N)C2)OC1(C)C |
| InChI | InChI=1S/C16H30BNO4/c1-14(2)15(3,4)22-17(21-14)10-6-5-8-16(13(19)20)9-7-12(18)11-16/h12H,5-11,18H2,1-4H3,(H,19,20)/t12-,16+/m0/s1 |
| InChIKey | MOMBGOUKVCGGHW-BLLLJJGKSA-N |
| XLogP | 2.83 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|