C10H20BNO4 — CID 158364506
trans-(1R,3S)-3-amino-1-(4-boronobutyl)cyclopentane-1-carboxylic acid (PubChem CID 158364506) has the molecular formula C10H20BNO4 and a molecular weight of 229.08 g/mol. Its IUPAC name is trans-(1R,3S)-3-amino-1-(4-boronobutyl)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-amino-1-(4-boronobutyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 158364506 |
| Molecular Formula | C10H20BNO4 |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | trans-(1R,3S)-3-amino-1-(4-boronobutyl)cyclopentane-1-carboxylic acid |
| SMILES | N[C@H]1CC[C@@](CCCCB(O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C10H20BNO4/c12-8-3-5-10(7-8,9(13)14)4-1-2-6-11(15)16/h8,15-16H,1-7,12H2,(H,13,14)/t8-,10+/m0/s1 |
| InChIKey | GTWAWLFDAUCEQI-WCBMZHEXSA-N |
| XLogP | 0.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|