C11H22BNO4 — CID 165064850
(4S)-2-(4-boronobutyl)-4-methylpiperidine-2-carboxylic acid (PubChem CID 165064850) has the molecular formula C11H22BNO4 and a molecular weight of 243.11 g/mol. Its IUPAC name is (4S)-2-(4-boronobutyl)-4-methylpiperidine-2-carboxylic acid.
| Compound Name | (4S)-2-(4-boronobutyl)-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 165064850 |
| Molecular Formula | C11H22BNO4 |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (4S)-2-(4-boronobutyl)-4-methylpiperidine-2-carboxylic acid |
| SMILES | C[C@H]1CCNC(CCCCB(O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C11H22BNO4/c1-9-4-7-13-11(8-9,10(14)15)5-2-3-6-12(16)17/h9,13,16-17H,2-8H2,1H3,(H,14,15)/t9-,11?/m0/s1 |
| InChIKey | RUIRSXZYVQJXJR-FTNKSUMCSA-N |
| XLogP | 0.47 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|