C8H13ClFNO2 — CID 175793603
(2R,4S)-2-(3-chloropropyl)-4-fluoropyrrolidine-2-carboxylic acid (PubChem CID 175793603) has the molecular formula C8H13ClFNO2 and a molecular weight of 209.65 g/mol. Its IUPAC name is (2R,4S)-2-(3-chloropropyl)-4-fluoropyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-2-(3-chloropropyl)-4-fluoropyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175793603 |
| Molecular Formula | C8H13ClFNO2 |
| Molecular Weight | 209.65 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (2R,4S)-2-(3-chloropropyl)-4-fluoropyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(CCCCl)C[C@H](F)CN1 |
| InChI | InChI=1S/C8H13ClFNO2/c9-3-1-2-8(7(12)13)4-6(10)5-11-8/h6,11H,1-5H2,(H,12,13)/t6-,8+/m0/s1 |
| InChIKey | BBJBQCJAYQRIMD-POYBYMJQSA-N |
| XLogP | 1.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.65 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|