C14H16Cl2FNO — CID 58017268
(3,4-dichlorophenyl)-[(4R)-4-fluoro-2-propylpyrrolidin-2-yl]methanone (PubChem CID 58017268) has the molecular formula C14H16Cl2FNO and a molecular weight of 304.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[(4R)-4-fluoro-2-propylpyrrolidin-2-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[(4R)-4-fluoro-2-propylpyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 58017268 |
| Molecular Formula | C14H16Cl2FNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (3,4-dichlorophenyl)-[(4R)-4-fluoro-2-propylpyrrolidin-2-yl]methanone |
| SMILES | CCCC1(C(=O)c2ccc(Cl)c(Cl)c2)C[C@@H](F)CN1 |
| InChI | InChI=1S/C14H16Cl2FNO/c1-2-5-14(7-10(17)8-18-14)13(19)9-3-4-11(15)12(16)6-9/h3-4,6,10,18H,2,5,7-8H2,1H3/t10-,14?/m1/s1 |
| InChIKey | ASTQCAFHEFNUII-IAPIXIRKSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |