C15H19Cl2NO — CID 59744722
(3,4-dichlorophenyl)-(3-propylpiperidin-3-yl)methanone (PubChem CID 59744722) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3-propylpiperidin-3-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(3-propylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 59744722 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (3,4-dichlorophenyl)-(3-propylpiperidin-3-yl)methanone |
| SMILES | CCCC1(C(=O)c2ccc(Cl)c(Cl)c2)CCCNC1 |
| InChI | InChI=1S/C15H19Cl2NO/c1-2-6-15(7-3-8-18-10-15)14(19)11-4-5-12(16)13(17)9-11/h4-5,9,18H,2-3,6-8,10H2,1H3 |
| InChIKey | ZFNRTPJFVBEJML-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |