C20H22ClNOS — CID 44547630
(4-chloro-3-phenylsulfanylphenyl)-(3-propylpyrrolidin-3-yl)methanone (PubChem CID 44547630) has the molecular formula C20H22ClNOS and a molecular weight of 359.92 g/mol. Its IUPAC name is (4-chloro-3-phenylsulfanylphenyl)-(3-propylpyrrolidin-3-yl)methanone.
| Compound Name | (4-chloro-3-phenylsulfanylphenyl)-(3-propylpyrrolidin-3-yl)methanone |
|---|---|
| PubChem CID | 44547630 |
| Molecular Formula | C20H22ClNOS |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (4-chloro-3-phenylsulfanylphenyl)-(3-propylpyrrolidin-3-yl)methanone |
| SMILES | CCCC1(C(=O)c2ccc(Cl)c(Sc3ccccc3)c2)CCNC1 |
| InChI | InChI=1S/C20H22ClNOS/c1-2-10-20(11-12-22-14-20)19(23)15-8-9-17(21)18(13-15)24-16-6-4-3-5-7-16/h3-9,13,22H,2,10-12,14H2,1H3 |
| InChIKey | ZMEMZLSTSMYENA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |