C16H21Cl2NO — CID 116569754
2-(2,5-dichlorophenyl)-1-(3-propylpiperidin-3-yl)ethanone (PubChem CID 116569754) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(3-propylpiperidin-3-yl)ethanone.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(3-propylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 116569754 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(3-propylpiperidin-3-yl)ethanone |
| SMILES | CCCC1(C(=O)Cc2cc(Cl)ccc2Cl)CCCNC1 |
| InChI | InChI=1S/C16H21Cl2NO/c1-2-6-16(7-3-8-19-11-16)15(20)10-12-9-13(17)4-5-14(12)18/h4-5,9,19H,2-3,6-8,10-11H2,1H3 |
| InChIKey | GASIEZSWDYYXLQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |