C16H21ClFNO — CID 102865090
2-(3-chloro-2-fluorophenyl)-1-(3-propylpiperidin-3-yl)ethanone (PubChem CID 102865090) has the molecular formula C16H21ClFNO and a molecular weight of 297.80 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(3-propylpiperidin-3-yl)ethanone.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(3-propylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 102865090 |
| Molecular Formula | C16H21ClFNO |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(3-propylpiperidin-3-yl)ethanone |
| SMILES | CCCC1(C(=O)Cc2cccc(Cl)c2F)CCCNC1 |
| InChI | InChI=1S/C16H21ClFNO/c1-2-7-16(8-4-9-19-11-16)14(20)10-12-5-3-6-13(17)15(12)18/h3,5-6,19H,2,4,7-11H2,1H3 |
| InChIKey | AAQVXCGLXHSWIO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |