C8H13FINO2 — CID 174165253
(2S,4S)-4-fluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid (PubChem CID 174165253) has the molecular formula C8H13FINO2 and a molecular weight of 301.10 g/mol. Its IUPAC name is (2S,4S)-4-fluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-fluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174165253 |
| Molecular Formula | C8H13FINO2 |
| Molecular Weight | 301.10 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | (2S,4S)-4-fluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(CCCI)C[C@H](F)CN1 |
| InChI | InChI=1S/C8H13FINO2/c9-6-4-8(7(12)13,11-5-6)2-1-3-10/h6,11H,1-5H2,(H,12,13)/t6-,8-/m0/s1 |
| InChIKey | VDSBDHCRYTUZON-XPUUQOCRSA-N |
| XLogP | 1.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.10 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|