C10H15ClFNO2 — CID 172577349
methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-fluoropyrrolidine-2-carboxylate (PubChem CID 172577349) has the molecular formula C10H15ClFNO2 and a molecular weight of 235.69 g/mol. Its IUPAC name is methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-fluoropyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-fluoropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 172577349 |
| Molecular Formula | C10H15ClFNO2 |
| Molecular Weight | 235.69 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-fluoropyrrolidine-2-carboxylate |
| SMILES | C=C(CCl)C[C@@]1(C(=O)OC)C[C@@H](F)CN1 |
| InChI | InChI=1S/C10H15ClFNO2/c1-7(5-11)3-10(9(14)15-2)4-8(12)6-13-10/h8,13H,1,3-6H2,2H3/t8-,10+/m1/s1 |
| InChIKey | UIDVBMXPTDLRSB-SCZZXKLOSA-N |
| XLogP | 1.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.69 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|