C11H16ClNO2 — CID 166095781
methyl (1S,5S)-3-[2-(chloromethyl)prop-2-enyl]-2-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 166095781) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is methyl (1S,5S)-3-[2-(chloromethyl)prop-2-enyl]-2-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | methyl (1S,5S)-3-[2-(chloromethyl)prop-2-enyl]-2-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 166095781 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | methyl (1S,5S)-3-[2-(chloromethyl)prop-2-enyl]-2-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | C=C(CCl)CC1(C(=O)OC)C[C@@H]2C[C@@H]2N1 |
| InChI | InChI=1S/C11H16ClNO2/c1-7(6-12)4-11(10(14)15-2)5-8-3-9(8)13-11/h8-9,13H,1,3-6H2,2H3/t8-,9-,11?/m0/s1 |
| InChIKey | GVYIGPCFAYNKMX-HBEAOTSJSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|