C8H12ClF2NO2 — CID 170992175
methyl (2R)-2-(2-chloroethyl)-4,4-difluoropyrrolidine-2-carboxylate (PubChem CID 170992175) has the molecular formula C8H12ClF2NO2 and a molecular weight of 227.64 g/mol. Its IUPAC name is methyl (2R)-2-(2-chloroethyl)-4,4-difluoropyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-2-(2-chloroethyl)-4,4-difluoropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170992175 |
| Molecular Formula | C8H12ClF2NO2 |
| Molecular Weight | 227.64 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | methyl (2R)-2-(2-chloroethyl)-4,4-difluoropyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@]1(CCCl)CC(F)(F)CN1 |
| InChI | InChI=1S/C8H12ClF2NO2/c1-14-6(13)7(2-3-9)4-8(10,11)5-12-7/h12H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | IWPYZJDRHMUTHI-ZETCQYMHSA-N |
| XLogP | 1.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.64 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|