C16H32BN3O5 — CID 175868953
4-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid (PubChem CID 175868953) has the molecular formula C16H32BN3O5 and a molecular weight of 357.26 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid.
| Compound Name | 4-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175868953 |
| Molecular Formula | C16H32BN3O5 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 4-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-(4-boronobutyl)piperidine-2-carboxylic acid |
| SMILES | CC(C)C[C@H](N)C(=O)NC1CCNC(CCCCB(O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C16H32BN3O5/c1-11(2)9-13(18)14(21)20-12-5-8-19-16(10-12,15(22)23)6-3-4-7-17(24)25/h11-13,19,24-25H,3-10,18H2,1-2H3,(H,20,21)(H,22,23)/t12?,13-,16?/m0/s1 |
| InChIKey | WURKOUVKKRCCNK-UYJPIKCFSA-N |
| XLogP | -0.31 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|