C17H33BN2O5 — CID 164994753
trans-(1R,3S)-3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid (PubChem CID 164994753) has the molecular formula C17H33BN2O5 and a molecular weight of 356.27 g/mol. Its IUPAC name is trans-(1R,3S)-3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164994753 |
| Molecular Formula | C17H33BN2O5 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | trans-(1R,3S)-3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)[C@H](N)C(=O)N[C@H]1CCC[C@@](CCCCB(O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C17H33BN2O5/c1-16(2,3)13(19)14(21)20-12-7-6-9-17(11-12,15(22)23)8-4-5-10-18(24)25/h12-13,24-25H,4-11,19H2,1-3H3,(H,20,21)(H,22,23)/t12-,13+,17+/m0/s1 |
| InChIKey | JDBKSVKGJYMSPT-OGHNNQOOSA-N |
| XLogP | 1.13 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|