C16H34BN3O5 — CID 154674949
4-[(2-amino-3,3-dimethylbutanoyl)amino]piperidine-2-carboxylic acid;butylboronic acid (PubChem CID 154674949) has the molecular formula C16H34BN3O5 and a molecular weight of 359.28 g/mol. Its IUPAC name is 4-[(2-amino-3,3-dimethylbutanoyl)amino]piperidine-2-carboxylic acid;butylboronic acid.
| Compound Name | 4-[(2-amino-3,3-dimethylbutanoyl)amino]piperidine-2-carboxylic acid;butylboronic acid |
|---|---|
| PubChem CID | 154674949 |
| Molecular Formula | C16H34BN3O5 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-[(2-amino-3,3-dimethylbutanoyl)amino]piperidine-2-carboxylic acid;butylboronic acid |
| SMILES | CC(C)(C)C(N)C(=O)NC1CCNC(C(=O)O)C1.CCCCB(O)O |
| InChI | InChI=1S/C12H23N3O3.C4H11BO2/c1-12(2,3)9(13)10(16)15-7-4-5-14-8(6-7)11(17)18;1-2-3-4-5(6)7/h7-9,14H,4-6,13H2,1-3H3,(H,15,16)(H,17,18);6-7H,2-4H2,1H3 |
| InChIKey | XJUNXHWGOPBIQO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|