C13H28BN3O5 — CID 156735679
(2R,4S)-4-[[(2S)-2-aminopropanoyl]amino]piperidine-2-carboxylic acid;butylboronic acid (PubChem CID 156735679) has the molecular formula C13H28BN3O5 and a molecular weight of 317.20 g/mol. Its IUPAC name is (2R,4S)-4-[[(2S)-2-aminopropanoyl]amino]piperidine-2-carboxylic acid;butylboronic acid.
| Compound Name | (2R,4S)-4-[[(2S)-2-aminopropanoyl]amino]piperidine-2-carboxylic acid;butylboronic acid |
|---|---|
| PubChem CID | 156735679 |
| Molecular Formula | C13H28BN3O5 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (2R,4S)-4-[[(2S)-2-aminopropanoyl]amino]piperidine-2-carboxylic acid;butylboronic acid |
| SMILES | CCCCB(O)O.C[C@H](N)C(=O)N[C@H]1CCN[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C9H17N3O3.C4H11BO2/c1-5(10)8(13)12-6-2-3-11-7(4-6)9(14)15;1-2-3-4-5(6)7/h5-7,11H,2-4,10H2,1H3,(H,12,13)(H,14,15);6-7H,2-4H2,1H3/t5-,6-,7+;/m0./s1 |
| InChIKey | CYSXMIBOBBCHFV-LBZPYWGZSA-N |
| XLogP | -1.09 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|