C13H25BN2O5 — CID 164949494
trans-(1R,3S)-3-[(2-aminoacetyl)amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid (PubChem CID 164949494) has the molecular formula C13H25BN2O5 and a molecular weight of 300.16 g/mol. Its IUPAC name is trans-(1R,3S)-3-[(2-aminoacetyl)amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-[(2-aminoacetyl)amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164949494 |
| Molecular Formula | C13H25BN2O5 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | trans-(1R,3S)-3-[(2-aminoacetyl)amino]-1-(4-boronobutyl)cyclohexane-1-carboxylic acid |
| SMILES | NCC(=O)N[C@H]1CCC[C@@](CCCCB(O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C13H25BN2O5/c15-9-11(17)16-10-4-3-6-13(8-10,12(18)19)5-1-2-7-14(20)21/h10,20-21H,1-9,15H2,(H,16,17)(H,18,19)/t10-,13+/m0/s1 |
| InChIKey | JBDIZCVTRROQGE-GXFFZTMASA-N |
| XLogP | -0.28 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|