C16H29BN2O4 — CID 167649309
trans-(1R,3S)-1-[4-[hydroxy(methyl)boranyl]butyl]-3-[[(2S)-pyrrolidine-2-carbonyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 167649309) has the molecular formula C16H29BN2O4 and a molecular weight of 324.23 g/mol. Its IUPAC name is trans-(1R,3S)-1-[4-[hydroxy(methyl)boranyl]butyl]-3-[[(2S)-pyrrolidine-2-carbonyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-1-[4-[hydroxy(methyl)boranyl]butyl]-3-[[(2S)-pyrrolidine-2-carbonyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 167649309 |
| Molecular Formula | C16H29BN2O4 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | trans-(1R,3S)-1-[4-[hydroxy(methyl)boranyl]butyl]-3-[[(2S)-pyrrolidine-2-carbonyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CB(O)CCCC[C@@]1(C(=O)O)CC[C@H](NC(=O)[C@@H]2CCCN2)C1 |
| InChI | InChI=1S/C16H29BN2O4/c1-17(23)9-3-2-7-16(15(21)22)8-6-12(11-16)19-14(20)13-5-4-10-18-13/h12-13,18,23H,2-11H2,1H3,(H,19,20)(H,21,22)/t12-,13-,16+/m0/s1 |
| InChIKey | OKTDLJFYYXIQEI-HEHGZKQESA-N |
| XLogP | 1.26 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|