C10H19N3O — CID 130638003
N-(1-ethylazetidin-3-yl)pyrrolidine-2-carboxamide (PubChem CID 130638003) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is N-(1-ethylazetidin-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(1-ethylazetidin-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 130638003 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-(1-ethylazetidin-3-yl)pyrrolidine-2-carboxamide |
| SMILES | CCN1CC(NC(=O)C2CCCN2)C1 |
| InChI | InChI=1S/C10H19N3O/c1-2-13-6-8(7-13)12-10(14)9-4-3-5-11-9/h8-9,11H,2-7H2,1H3,(H,12,14) |
| InChIKey | IOIOWKSWYKFIMB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |