C14H27ClN2O — CID 119304208
N-(4-propylcyclohexyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119304208) has the molecular formula C14H27ClN2O and a molecular weight of 274.84 g/mol. Its IUPAC name is N-(4-propylcyclohexyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(4-propylcyclohexyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119304208 |
| Molecular Formula | C14H27ClN2O |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-(4-propylcyclohexyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CCCC1CCC(NC(=O)C2CCCN2)CC1.Cl |
| InChI | InChI=1S/C14H26N2O.ClH/c1-2-4-11-6-8-12(9-7-11)16-14(17)13-5-3-10-15-13;/h11-13,15H,2-10H2,1H3,(H,16,17);1H |
| InChIKey | SLLRCOSJRZLDMS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |