C17H33BN2O4 — CID 155601138
1-(dimethylamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid (PubChem CID 155601138) has the molecular formula C17H33BN2O4 and a molecular weight of 340.27 g/mol. Its IUPAC name is 1-(dimethylamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(dimethylamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155601138 |
| Molecular Formula | C17H33BN2O4 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 1-(dimethylamino)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid |
| SMILES | CN(C)N1CCCC1(CCCCB1OC(C)(C)C(C)(C)O1)C(=O)O |
| InChI | InChI=1S/C17H33BN2O4/c1-15(2)16(3,4)24-18(23-15)12-8-7-10-17(14(21)22)11-9-13-20(17)19(5)6/h7-13H2,1-6H3,(H,21,22) |
| InChIKey | ONQWODQYXIXAPN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|