C9H15NO5 — CID 68708136
(2R)-2-(3-hydroxypropyl)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 68708136) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (2R)-2-(3-hydroxypropyl)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R)-2-(3-hydroxypropyl)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 68708136 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (2R)-2-(3-hydroxypropyl)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)N1CCC[C@@]1(CCCO)C(=O)O |
| InChI | InChI=1S/C9H15NO5/c11-6-2-4-9(7(12)13)3-1-5-10(9)8(14)15/h11H,1-6H2,(H,12,13)(H,14,15)/t9-/m1/s1 |
| InChIKey | DVFUHLHQALFXCF-SECBINFHSA-N |
| XLogP | 0.36 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |