C8H13NO4 — CID 91369752
(2R)-2-ethylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 91369752) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (2R)-2-ethylpyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R)-2-ethylpyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 91369752 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (2R)-2-ethylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC[C@]1(C(=O)O)CCCN1C(=O)O |
| InChI | InChI=1S/C8H13NO4/c1-2-8(6(10)11)4-3-5-9(8)7(12)13/h2-5H2,1H3,(H,10,11)(H,12,13)/t8-/m1/s1 |
| InChIKey | YBQBMUORLGMZAR-MRVPVSSYSA-N |
| XLogP | 0.99 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |