C28H50BN3O9 — CID 172727009
(2R,4S)-4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]piperidine-1,2-dicarboxylic acid (PubChem CID 172727009) has the molecular formula C28H50BN3O9 and a molecular weight of 583.53 g/mol. Its IUPAC name is (2R,4S)-4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]piperidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4S)-4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]piperidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 172727009 |
| Molecular Formula | C28H50BN3O9 |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | (2R,4S)-4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]piperidine-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N[C@H]1CCN(C(=O)O)[C@@](CCCCB2OC(C)(C)C(C)(C)O2)(C(=O)O)C1)C(C)(C)C |
| InChI | InChI=1S/C28H50BN3O9/c1-24(2,3)19(31-22(36)39-25(4,5)6)20(33)30-18-13-16-32(23(37)38)28(17-18,21(34)35)14-11-12-15-29-40-26(7,8)27(9,10)41-29/h18-19H,11-17H2,1-10H3,(H,30,33)(H,31,36)(H,34,35)(H,37,38)/t18-,19+,28+/m0/s1 |
| InChIKey | HGYDFRVBQRTWCD-DORSKGMSSA-N |
| XLogP | 4.27 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|