C30H43BN2O6 — CID 42637652
tert-butyl N-[1-oxo-1-(3-phenoxyanilino)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-yl]carbamate (PubChem CID 42637652) has the molecular formula C30H43BN2O6 and a molecular weight of 538.49 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-(3-phenoxyanilino)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-(3-phenoxyanilino)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-yl]carbamate |
|---|---|
| PubChem CID | 42637652 |
| Molecular Formula | C30H43BN2O6 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | tert-butyl N-[1-oxo-1-(3-phenoxyanilino)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCCB1OC(C)(C)C(C)(C)O1)C(=O)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C30H43BN2O6/c1-28(2,3)37-27(35)33-25(19-12-9-13-20-31-38-29(4,5)30(6,7)39-31)26(34)32-22-15-14-18-24(21-22)36-23-16-10-8-11-17-23/h8,10-11,14-18,21,25H,9,12-13,19-20H2,1-7H3,(H,32,34)(H,33,35) |
| InChIKey | ZJGGQRCSAPQUGT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|