C26H34BNO5 — CID 42637650
2-[(3-phenylphenyl)carbamoyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptanoic acid (PubChem CID 42637650) has the molecular formula C26H34BNO5 and a molecular weight of 451.37 g/mol. Its IUPAC name is 2-[(3-phenylphenyl)carbamoyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptanoic acid.
| Compound Name | 2-[(3-phenylphenyl)carbamoyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptanoic acid |
|---|---|
| PubChem CID | 42637650 |
| Molecular Formula | C26H34BNO5 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-[(3-phenylphenyl)carbamoyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptanoic acid |
| SMILES | CC1(C)OB(CCCCCC(C(=O)O)C(=O)Nc2cccc(-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C26H34BNO5/c1-25(2)26(3,4)33-27(32-25)17-10-6-9-16-22(24(30)31)23(29)28-21-15-11-14-20(18-21)19-12-7-5-8-13-19/h5,7-8,11-15,18,22H,6,9-10,16-17H2,1-4H3,(H,28,29)(H,30,31) |
| InChIKey | QWSCZZMAQRZXNW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|