C27H48BN3O9 — CID 174145196
(2R,4R)-4-[[(2S)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 174145196) has the molecular formula C27H48BN3O9 and a molecular weight of 569.51 g/mol. Its IUPAC name is (2R,4R)-4-[[(2S)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4R)-4-[[(2S)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 174145196 |
| Molecular Formula | C27H48BN3O9 |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 569.35 |
| IUPAC Name | (2R,4R)-4-[[(2S)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC(C)[C@](C)(NC(=O)OC(C)(C)C)C(=O)N[C@H]1CN(C(=O)O)[C@@](CCCCB2OC(C)(C)C(C)(C)O2)(C(=O)O)C1 |
| InChI | InChI=1S/C27H48BN3O9/c1-17(2)26(10,30-21(35)38-23(3,4)5)19(32)29-18-15-27(20(33)34,31(16-18)22(36)37)13-11-12-14-28-39-24(6,7)25(8,9)40-28/h17-18H,11-16H2,1-10H3,(H,29,32)(H,30,35)(H,33,34)(H,36,37)/t18-,26+,27-/m1/s1 |
| InChIKey | BZFRZSQBTNXHJP-BLIZRMSTSA-N |
| XLogP | 3.88 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|