C26H48BN3O7 — CID 153335131
(2R,4R)-4-[methyl-[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid (PubChem CID 153335131) has the molecular formula C26H48BN3O7 and a molecular weight of 525.50 g/mol. Its IUPAC name is (2R,4R)-4-[methyl-[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-[methyl-[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 153335131 |
| Molecular Formula | C26H48BN3O7 |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | (2R,4R)-4-[methyl-[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N(C)[C@H]1CN[C@@](CCCCB2OC(C)(C)C(C)(C)O2)(C(=O)O)C1 |
| InChI | InChI=1S/C26H48BN3O7/c1-17(2)19(29-22(34)35-23(3,4)5)20(31)30(10)18-15-26(21(32)33,28-16-18)13-11-12-14-27-36-24(6,7)25(8,9)37-27/h17-19,28H,11-16H2,1-10H3,(H,29,34)(H,32,33)/t18-,19+,26-/m1/s1 |
| InChIKey | XZGORRAEAFALRZ-UYXZNNOOSA-N |
| XLogP | 3.44 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|