C23H43BN2O7 — CID 175729941
3-[[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid (PubChem CID 175729941) has the molecular formula C23H43BN2O7 and a molecular weight of 470.42 g/mol. Its IUPAC name is 3-[[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid.
| Compound Name | 3-[[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 175729941 |
| Molecular Formula | C23H43BN2O7 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 3-[[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(CCCB1OC(C)(C)C(C)(C)O1)CC(=O)O |
| InChI | InChI=1S/C23H43BN2O7/c1-15(2)18(26-20(30)31-21(3,4)5)19(29)25-14-16(13-17(27)28)11-10-12-24-32-22(6,7)23(8,9)33-24/h15-16,18H,10-14H2,1-9H3,(H,25,29)(H,26,30)(H,27,28)/t16?,18-/m0/s1 |
| InChIKey | FNQOZROGTICDTI-DAFXYXGESA-N |
| XLogP | 3.62 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|